Ac4ManNAz 95% (mixture of isomers)
cas: 361154-30-5 — see every product listed under this CAS number, including other names
Ac4ManNAz 95% (mixture of isomers) (CAS 361154-30-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 1g, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1145420-25mg |
| cas | 361154-30-5 |
| size | 25mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 737.50 Pln | |
| Ambeed | 1g | 12513.31 Pln | |
| Ambeed | 50mg | 1193.62 Pln | |
| Ambeed | 100mg | 2144.81 Pln | |
| Ambeed | 250mg | 4681.31 Pln |
properties
| purity | 95% (mixture of isomers) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1145420 |
[(2R,3S,4R,5S)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate (CAS 361154-30-5) is a chemical compound with the molecular formula C16H22N4O10 and a molecular weight of 430.37 g/mol. IUPAC name: [(2R,3S,4R,5S)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate. InChIKey: HGMISDAXLUIXKM-LIADDWGISA-N.
| Molecular formula | C16H22N4O10 |
|---|---|
| Molecular weight | 430.37 g/mol |
| IUPAC name | [(2R,3S,4R,5S)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate |
| InChIKey | HGMISDAXLUIXKM-LIADDWGISA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H](C(O1)OC(=O)C)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)