CAS 19245-85-3 appears in our catalog under these names: Acetyltrialanine/ 99.53% (existing batch purity), Ac–Ala–Ala–Ala–OH, Ac-Ala-Ala-Ala-OH, Acetyltrialanine, Acetyltrialanine, 99.16%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1g.
(2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]amino]propanoic acid (CAS 19245-85-3) is a chemical compound with the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]amino]propanoic acid. InChIKey: DRYOODAJROGPQO-ACZMJKKPSA-N.
| Molecular formula | C11H19N3O5 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]amino]propanoic acid |
| InChIKey | DRYOODAJROGPQO-ACZMJKKPSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)