Acid-PEG1-C2-Boc 95%
cas: 2086689-08-7 — see every product listed under this CAS number, including other names
Acid-PEG1-C2-Boc 95% (CAS 2086689-08-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A762531-100mg |
| cas | 2086689-08-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1143.56 Pln | |
| Ambeed | 5g | 4364.25 Pln | |
| Ambeed | 25g | 15099.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A762531 |
3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propanoic acid (CAS 2086689-08-7) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: 3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propanoic acid. InChIKey: ZDYGOKORAHMWLC-UHFFFAOYSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propanoic acid |
| InChIKey | ZDYGOKORAHMWLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Acid-PEG1-t-butyl ester, Acid-PEG1-C2-Boc, 3-(3-(tert-butoxy)-3-oxopropoxy)propanoic acid, 3-[3-(tert-butoxy)-3-oxopropoxy]propanoic acid, 3-(3-tert-butoxy-3-oxo-propoxy)propanoic acid, 3-(2-Carboxyethoxy)propanoic acid 1-tert-butyl ester, COOH-PEG1-OtBu, orb1909544, 3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propanoic acid