Products 2086689-08-7
CAS 2086689-08-7 appears in our catalog under these names: Acid-peg1-t-butyl ester, 95%, Acid–PEG1–C2–Boc, Acid-PEG1-C2-Boc 95%, 3-(3-(tert-Butoxy)-3-oxopropoxy)propanoic acid, 98%, 98%, Acid-PEG1-C2-Boc, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 10g, 100 mg, 5 g.
3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propanoic acid (CAS 2086689-08-7) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: 3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propanoic acid. InChIKey: ZDYGOKORAHMWLC-UHFFFAOYSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propanoic acid |
| InChIKey | ZDYGOKORAHMWLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Acid-PEG1-t-butyl ester, Acid-PEG1-C2-Boc, 3-(3-(tert-butoxy)-3-oxopropoxy)propanoic acid, 3-[3-(tert-butoxy)-3-oxopropoxy]propanoic acid, 3-(3-tert-butoxy-3-oxo-propoxy)propanoic acid, 3-(2-Carboxyethoxy)propanoic acid 1-tert-butyl ester, COOH-PEG1-OtBu, orb1909544, 3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propanoic acid