cas: 1309460-29-4 — see every product listed under this CAS number, including other names
Acid-PEG5-C2-Boc (CAS 1309460-29-4) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T14108-2mg |
| cas | 1309460-29-4 |
| size | 2mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 458.82 Pln | |
| TargetMol | 5mg | 611.98 Pln | |
| TargetMol | 10mg | 797.57 Pln | |
| TargetMol | 25mg | 1182.72 Pln | |
| TargetMol | 50mg | 1641.10 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 26 days |
3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1309460-29-4) is a chemical compound with the molecular formula C18H34O9 and a molecular weight of 394.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ILIIUHKWCBCCNI-UHFFFAOYSA-N.
| Molecular formula | C18H34O9 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ILIIUHKWCBCCNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)