Acid-PEG5-C2-Boc, 98%
cas: 1309460-29-4 — see every product listed under this CAS number, including other names
Acid-PEG5-C2-Boc, 98% (CAS 1309460-29-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554730-100MG |
| cas | 1309460-29-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 638.33 Pln | |
| Fluorochem | 250mg | 1226.67 Pln | |
| Fluorochem | 1g | 2955.23 Pln | |
| Fluorochem | 5g | 8213.79 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1309460-29-4) is a chemical compound with the molecular formula C18H34O9 and a molecular weight of 394.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ILIIUHKWCBCCNI-UHFFFAOYSA-N.
| Molecular formula | C18H34O9 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ILIIUHKWCBCCNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)