CAS 1229453-99-9 appears in our catalog under these names: Acrizanib, 99%, 99%, Acrizanib 99%, Acrizanib/ 98.71% (existing batch purity), Acrizanib, Acrizanib (LHA510). Offered by: Chemat, Ambeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
5-[6-(methylaminomethyl)pyrimidin-4-yl]oxy-N-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]indole-1-carboxamide (CAS 1229453-99-9) is a chemical compound with the molecular formula C20H18F3N7O2 and a molecular weight of 445.4 g/mol. IUPAC name: 5-[6-(methylaminomethyl)pyrimidin-4-yl]oxy-N-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]indole-1-carboxamide. InChIKey: XPIHPLVWOUDMPF-UHFFFAOYSA-N.
| Molecular formula | C20H18F3N7O2 |
|---|---|
| Molecular weight | 445.4 g/mol |
| IUPAC name | 5-[6-(methylaminomethyl)pyrimidin-4-yl]oxy-N-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]indole-1-carboxamide |
| InChIKey | XPIHPLVWOUDMPF-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=NC=N1)OC2=CC3=C(C=C2)N(C=C3)C(=O)NC4=NN(C(=C4)C(F)(F)F)C |
Computed by PubChem (NCBI)