CAS 2171019-55-7 appears in our catalog under these names: Afimetoran/ 99.89% (existing batch purity), Afimetoran, BMS-986256, 95%, 95%, Afimetoran, 99.37%, Afimetoran, 95%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
2-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]acetamide (CAS 2171019-55-7) is a chemical compound with the molecular formula C26H32N6O and a molecular weight of 444.6 g/mol. IUPAC name: 2-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]acetamide. InChIKey: SNFVHLQYHFQOEP-UHFFFAOYSA-N.
| Molecular formula | C26H32N6O |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | 2-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]acetamide |
| InChIKey | SNFVHLQYHFQOEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC=NN2C=C1C3=C(C4=C(N3)C=CC(=C4)C5CCN(CC5)CC(=O)N)C(C)C)C |
Computed by PubChem (NCBI)