CAS 1188910-76-0 appears in our catalog under these names: Agerafenib/ 99.23% (existing batch purity), CEP–32496, CEP 32496, Agerafenib 99%, CEP-32496, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]urea (CAS 1188910-76-0) is a chemical compound with the molecular formula C24H22F3N5O5 and a molecular weight of 517.5 g/mol. IUPAC name: 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]urea. InChIKey: DKNUPRMJNUQNHR-UHFFFAOYSA-N.
| Molecular formula | C24H22F3N5O5 |
|---|---|
| Molecular weight | 517.5 g/mol |
| IUPAC name | 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]urea |
| InChIKey | DKNUPRMJNUQNHR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=NO1)NC(=O)NC2=CC(=CC=C2)OC3=NC=NC4=CC(=C(C=C43)OC)OC)C(F)(F)F |
Computed by PubChem (NCBI)