cas: 2338747-54-7 — see every product listed under this CAS number, including other names
AHR antagonist 2 (CAS 2338747-54-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 250mg, 5mg, 50mg, 25mg, 200mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC39669-10 |
| cas | 2338747-54-7 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 2150.97 Pln | |
| GLPBio | 100mg | 6925.08 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1608.03 Pln | |
| GLPBio | 250mg | 9958.04 Pln | |
| GLPBio | 5mg | 1500.38 Pln | |
| GLPBio | 50mg | 4664.39 Pln | |
| Biosynth | 50mg | price on request | |
| Biosynth | 25mg | price on request | |
| Chemat | 25mg | 1835.60 Pln | |
| Chemat | 200mg | 5138.00 Pln | |
| Chemat | 1mg | 338.00 Pln | |
| Chemat | 5mg | 741.20 Pln | |
| Chemat | 10mg | 1149.20 Pln | |
| Chemat | 50mg | 2579.60 Pln | |
| Chemat | 100mg | 3654.80 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[(2S)-1-hydroxypropan-2-yl]-2-pyridin-3-yl-6-[4-(trifluoromethoxy)phenyl]pyrimidine-4-carboxamide (CAS 2338747-54-7) is a chemical compound with the molecular formula C20H17F3N4O3 and a molecular weight of 418.4 g/mol. IUPAC name: N-[(2S)-1-hydroxypropan-2-yl]-2-pyridin-3-yl-6-[4-(trifluoromethoxy)phenyl]pyrimidine-4-carboxamide. InChIKey: CSSGBPKFVJOAIZ-LBPRGKRZSA-N.
| Molecular formula | C20H17F3N4O3 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | N-[(2S)-1-hydroxypropan-2-yl]-2-pyridin-3-yl-6-[4-(trifluoromethoxy)phenyl]pyrimidine-4-carboxamide |
| InChIKey | CSSGBPKFVJOAIZ-LBPRGKRZSA-N |
| SMILES | C[C@@H](CO)NC(=O)C1=NC(=NC(=C1)C2=CC=C(C=C2)OC(F)(F)F)C3=CN=CC=C3 |
Computed by PubChem (NCBI)