cas: 1807518-64-4 — see every product listed under this CAS number, including other names
Ald-Ph-PEG4-Boc 97% (CAS 1807518-64-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A969586-100mg |
| cas | 1807518-64-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 3919.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A969586 |
Tert-butyl 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1807518-64-4) is a chemical compound with the molecular formula C23H35NO8 and a molecular weight of 453.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: LWNKMVXZTVDYHO-UHFFFAOYSA-N.
| Molecular formula | C23H35NO8 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | LWNKMVXZTVDYHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)