cas: 1807518-64-4 — see every product listed under this CAS number, including other names
tert-Butyl 1-(4-formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oate, 95%, 95% (CAS 1807518-64-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I18N-100mg |
| cas | 1807518-64-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 500mg | 611.60 Pln | |
| Chemat | 1g | 803.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1807518-64-4) is a chemical compound with the molecular formula C23H35NO8 and a molecular weight of 453.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: LWNKMVXZTVDYHO-UHFFFAOYSA-N.
| Molecular formula | C23H35NO8 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | LWNKMVXZTVDYHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)