cas: 1807521-09-0 — see every product listed under this CAS number, including other names
Ald-Ph-amido-PEG2-C2-Boc, 97% (CAS 1807521-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987034-100MG |
| cas | 1807521-09-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 752.88 Pln | |
| Fluorochem | 250mg | 1788.97 Pln | |
| Fluorochem | 500mg | 2481.44 Pln | |
| Fluorochem | 1g | 3330.10 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate (CAS 1807521-09-0) is a chemical compound with the molecular formula C19H27NO6 and a molecular weight of 365.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate. InChIKey: UXMPBIQFYCJYBB-UHFFFAOYSA-N.
| Molecular formula | C19H27NO6 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate |
| InChIKey | UXMPBIQFYCJYBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCNC(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)