cas: 129318-43-0 — see every product listed under this CAS number, including other names
Alendronate sodium, 98% 16-17%H2O, 98% 16-17%H2O (CAS 129318-43-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRY4-5g |
| cas | 129318-43-0 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 189.20 Pln | |
| Chemat | 25g | 414.80 Pln | |
| Chemat | 100g | 1278.80 Pln |
| purity | 98% 16-17%H2O |
|---|---|
| delivery time | 3 weeks |
Sodium (4-amino-1-hydroxy-1-phosphonobutyl)-hydroxyphosphinate (CAS 129318-43-0) is a chemical compound with the molecular formula C4H12NNaO7P2 and a molecular weight of 271.08 g/mol. IUPAC name: sodium (4-amino-1-hydroxy-1-phosphonobutyl)-hydroxyphosphinate. InChIKey: CAKRAHQRJGUPIG-UHFFFAOYSA-M.
| Molecular formula | C4H12NNaO7P2 |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | sodium (4-amino-1-hydroxy-1-phosphonobutyl)-hydroxyphosphinate |
| InChIKey | CAKRAHQRJGUPIG-UHFFFAOYSA-M |
| SMILES | C(CC(O)(P(=O)(O)O)P(=O)(O)[O-])CN.[Na+] |
Computed by PubChem (NCBI)