CAS 129318-43-0 appears in our catalog under these names: Alendronate sodium, 98%, (4-Amino-1-hydroxybutane-1,1-diyl)diphosphonic acid, sodium salt, 97%, Alendronic Acid Sodium Salt, Alendronate sodium, Alendronate sodium, 98% 16-17%H2O, 98% 16-17%H2O. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 250mg, 25g, 1g, on request, 10mM (in 1ml water), 500mg, 100g.
Sodium (4-amino-1-hydroxy-1-phosphonobutyl)-hydroxyphosphinate (CAS 129318-43-0) is a chemical compound with the molecular formula C4H12NNaO7P2 and a molecular weight of 271.08 g/mol. IUPAC name: sodium (4-amino-1-hydroxy-1-phosphonobutyl)-hydroxyphosphinate. InChIKey: CAKRAHQRJGUPIG-UHFFFAOYSA-M.
| Molecular formula | C4H12NNaO7P2 |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | sodium (4-amino-1-hydroxy-1-phosphonobutyl)-hydroxyphosphinate |
| InChIKey | CAKRAHQRJGUPIG-UHFFFAOYSA-M |
| SMILES | C(CC(O)(P(=O)(O)O)P(=O)(O)[O-])CN.[Na+] |
Computed by PubChem (NCBI)