Products 9024-15-1
CAS 9024-15-1 appears in our catalog under these names: Alginate lyase, Alginate Lyase powder, >= 10,000unit/g s. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: 10 mg, 5 mg, 100MG.
2,2,4,5,5-pentamethyl-3-prop-1-enylcyclohex-3-en-1-amine (CAS 9024-15-1) is a chemical compound with the molecular formula C14H25N and a molecular weight of 207.35 g/mol. IUPAC name: 2,2,4,5,5-pentamethyl-3-prop-1-enylcyclohex-3-en-1-amine. InChIKey: LPQSWFPLDCZNCO-UHFFFAOYSA-N.
| Molecular formula | C14H25N |
|---|---|
| Molecular weight | 207.35 g/mol |
| IUPAC name | 2,2,4,5,5-pentamethyl-3-prop-1-enylcyclohex-3-en-1-amine |
| InChIKey | LPQSWFPLDCZNCO-UHFFFAOYSA-N |
| SMILES | CC=CC1=C(C(CC(C1(C)C)N)(C)C)C |
Computed by PubChem (NCBI)