cas: 1343407-91-9 — see every product listed under this CAS number, including other names
Alloc-Val-Ala-PAB-OH, 98% (CAS 1343407-91-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F611324-50MG |
| cas | 1343407-91-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 221.81 Pln | |
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (CAS 1343407-91-9) is a chemical compound with the molecular formula C19H27N3O5 and a molecular weight of 377.4 g/mol. IUPAC name: prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: LVLAVLCLIPDFJK-BBRMVZONSA-N.
| Molecular formula | C19H27N3O5 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | LVLAVLCLIPDFJK-BBRMVZONSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)CO)NC(=O)[C@H](C(C)C)NC(=O)OCC=C |
Computed by PubChem (NCBI)