cas: 1343407-91-9 — see every product listed under this CAS number, including other names
Allyl ((S)-1-(((S)-1-((4-(Hydroxymethyl)Phenyl)amino)-1-Oxopropan-2-yl)Amino)-3-Methyl-1-Oxobutan-2-yl)Carbamate, 97%, 97% (CAS 1343407-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JLRV-100mg |
| cas | 1343407-91-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 500mg | 333.20 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 1384.40 Pln | |
| Chemat | 25g | 4898.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (CAS 1343407-91-9) is a chemical compound with the molecular formula C19H27N3O5 and a molecular weight of 377.4 g/mol. IUPAC name: prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: LVLAVLCLIPDFJK-BBRMVZONSA-N.
| Molecular formula | C19H27N3O5 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | LVLAVLCLIPDFJK-BBRMVZONSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)CO)NC(=O)[C@H](C(C)C)NC(=O)OCC=C |
Computed by PubChem (NCBI)