cas: 153774-39-1 — see every product listed under this CAS number, including other names
Allyl 3-amino-4-fluorobenzoate 97% (CAS 153774-39-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A197000-250mg |
| cas | 153774-39-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1482.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A197000 |
Prop-2-enyl 3-amino-4-fluorobenzoate (CAS 153774-39-1) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: prop-2-enyl 3-amino-4-fluorobenzoate. InChIKey: SNZWNIMUYPJNCE-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | prop-2-enyl 3-amino-4-fluorobenzoate |
| InChIKey | SNZWNIMUYPJNCE-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1=CC(=C(C=C1)F)N |
Computed by PubChem (NCBI)