cas: 72824-04-5 — see every product listed under this CAS number, including other names
Allylboronic acid, pinacol cyclic ester (CAS 72824-04-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F016097-1G |
| cas | 72824-04-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 200.99 Pln | |
| Fluorochem | 100g | 612.30 Pln |
| delivery time | 1-2 weeks |
|---|
4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane (CAS 72824-04-5) is a chemical compound with the molecular formula C9H17BO2 and a molecular weight of 168.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane. InChIKey: YMHIEPNFCBNQQU-UHFFFAOYSA-N.
| Molecular formula | C9H17BO2 |
|---|---|
| Molecular weight | 168.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane |
| InChIKey | YMHIEPNFCBNQQU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC=C |
Computed by PubChem (NCBI)