cas: 72824-04-5 — see every product listed under this CAS number, including other names
2-Allyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (stabilized with Phenothiazine), >96.0%(GC) (CAS 72824-04-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2157-1G |
| cas | 72824-04-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 208.35 Pln | |
| TCI | 5g | 424.70 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane (CAS 72824-04-5) is a chemical compound with the molecular formula C9H17BO2 and a molecular weight of 168.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane. InChIKey: YMHIEPNFCBNQQU-UHFFFAOYSA-N.
| Molecular formula | C9H17BO2 |
|---|---|
| Molecular weight | 168.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane |
| InChIKey | YMHIEPNFCBNQQU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC=C |
Computed by PubChem (NCBI)