cas: 2170987-85-4 — see every product listed under this CAS number, including other names
Amino-PEG10-acid, 97%, 97% (CAS 2170987-85-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JK9Z-50mg |
| cas | 2170987-85-4 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 256.40 Pln | |
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 669.20 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2170987-85-4) is a chemical compound with the molecular formula C23H47NO12 and a molecular weight of 529.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SVXUSQJNNODUGC-UHFFFAOYSA-N.
| Molecular formula | C23H47NO12 |
|---|---|
| Molecular weight | 529.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SVXUSQJNNODUGC-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)