CAS 2170987-85-4 appears in our catalog under these names: Amino-peg10-acid, 95%, Amino-PEG10-acid/ 99.07% (existing batch purity), Amino–PEG10–acid, Amino-PEG10-acid 98%, Amino-PEG10-acid, 97%, 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2170987-85-4) is a chemical compound with the molecular formula C23H47NO12 and a molecular weight of 529.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SVXUSQJNNODUGC-UHFFFAOYSA-N.
| Molecular formula | C23H47NO12 |
|---|---|
| Molecular weight | 529.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SVXUSQJNNODUGC-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)