Amino-PEG4-Azide, 98%, 98%
cas: 951671-92-4 — see every product listed under this CAS number, including other names
Amino-PEG4-Azide, 98%, 98% (CAS 951671-92-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IISQ-100mg |
| cas | 951671-92-4 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 500mg | 232.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 957.20 Pln | |
| Chemat | 25g | 2267.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine (CAS 951671-92-4) is a chemical compound with the molecular formula C10H22N4O4 and a molecular weight of 262.31 g/mol. IUPAC name: 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: ZMBGKXBIVYXREN-UHFFFAOYSA-N.
| Molecular formula | C10H22N4O4 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | ZMBGKXBIVYXREN-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCN=[N+]=[N-])N |
Computed by PubChem (NCBI)
Synonyms:
Azido-PEG4-Amine, 14-Azido-3,6,9,12-tetraoxatetradecan-1-amine, Amino-PEG4-azide, 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine, O-(2-Aminoethyl)-O'-(2-azidoethyl)triethylene Glycol, 14-Amino-3,6,9,12-tetraoxatetradecanyl Azide, 1-Amino-14-azido-3,6,9,12-tetraoxatetradecane, Azido-PEG4-NH2, Amino-PEG5-azide, O-(2-Aminoethyl)-O'-(2-azidoethyl)triethyleneGlycol