cas: 951671-92-4 — see every product listed under this CAS number, including other names
Azido-PEG4-Amine, >95.0%(GC) (CAS 951671-92-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A3004-50MG |
| cas | 951671-92-4 |
| size | 50mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 50mg | 386.86 Pln | |
| TCI | 250mg | 868.75 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine (CAS 951671-92-4) is a chemical compound with the molecular formula C10H22N4O4 and a molecular weight of 262.31 g/mol. IUPAC name: 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: ZMBGKXBIVYXREN-UHFFFAOYSA-N.
| Molecular formula | C10H22N4O4 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | ZMBGKXBIVYXREN-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCN=[N+]=[N-])N |
Computed by PubChem (NCBI)