cas: 1334169-96-8 — see every product listed under this CAS number, including other names
Amino-PEG8-hydrazide-Boc 95% (CAS 1334169-96-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755854-100mg |
| cas | 1334169-96-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 859.88 Pln | |
| Ambeed | 250mg | 1455.06 Pln | |
| Ambeed | 1g | 3752.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755854 |
Tert-butyl N-[3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate (CAS 1334169-96-8) is a chemical compound with the molecular formula C24H49N3O11 and a molecular weight of 555.7 g/mol. IUPAC name: tert-butyl N-[3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate. InChIKey: GKXIUVNZWFPOHI-UHFFFAOYSA-N.
| Molecular formula | C24H49N3O11 |
|---|---|
| Molecular weight | 555.7 g/mol |
| IUPAC name | tert-butyl N-[3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate |
| InChIKey | GKXIUVNZWFPOHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)