tert-Butyl 30-amino-4-oxo-7,10,13,16,19,22,25,28-octaoxa-2,3-diazatriacontan-1-oate, 95%, 95%
cas: 1334169-96-8 — see every product listed under this CAS number, including other names
tert-Butyl 30-amino-4-oxo-7,10,13,16,19,22,25,28-octaoxa-2,3-diazatriacontan-1-oate, 95%, 95% (CAS 1334169-96-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSWA-50mg |
| cas | 1334169-96-8 |
| size | 50mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 530.00 Pln | |
| Chemat | 100mg | 909.20 Pln | |
| Chemat | 250mg | 1504.40 Pln | |
| Chemat | 1g | 4542.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate (CAS 1334169-96-8) is a chemical compound with the molecular formula C24H49N3O11 and a molecular weight of 555.7 g/mol. IUPAC name: tert-butyl N-[3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate. InChIKey: GKXIUVNZWFPOHI-UHFFFAOYSA-N.
| Molecular formula | C24H49N3O11 |
|---|---|
| Molecular weight | 555.7 g/mol |
| IUPAC name | tert-butyl N-[3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate |
| InChIKey | GKXIUVNZWFPOHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)