Products 1397-89-3
CAS 1397-89-3 appears in our catalog under these names: Amphotericin b, 95%, Amphotericin B, Amphotericin B (85%), Amphotericin B (~80%), Amphotericin B. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 100g, 10g, 25g, 5g, 1g, on request, 100mg, 50mg.
Amphotericin B is a macrolide antibiotic used to treat potentially life-threatening fungal infections. It has a role as an antiamoebic agent, an antiprotozoal drug and a bacterial metabolite. It is a macrolide antibiotic, a polyene antibiotic and an antibiotic antifungal drug.
Source: ChEBI
| Molecular formula | C47H73NO17 |
|---|---|
| Molecular weight | 924.1 g/mol |
| IUPAC name | (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid |
| InChIKey | APKFDSVGJQXUKY-INPOYWNPSA-N |
| SMILES | C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O |
Computed by PubChem (NCBI)
Synonyms:
amphotericin b, Amphotericine B, Amfotericina B, Halizon, Ampho-Moronal, Amphotericinum B, Fungizone, Amphocin, Amphotec, Fungilin