Products 1518996-49-0
CAS 1518996-49-0 appears in our catalog under these names: Andecaliximab/ SDS-Page: 95%, SEC-HPLC: 95%, Andecaliximab, Andecaliximab, 99.0%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 1 mg, 25 mg, 10 mg, 5 mg.
1-bromo-2-fluoro-4-methoxy-3-nitrobenzene (CAS 1518996-49-0) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 1-bromo-2-fluoro-4-methoxy-3-nitrobenzene. InChIKey: LJJAOMRFFXQENV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-methoxy-3-nitrobenzene |
| InChIKey | LJJAOMRFFXQENV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)