cas: 6470-87-7 — see every product listed under this CAS number, including other names
Anthraquinone-2-carbonyl Chloride, >98.0%(HPLC)(T) (CAS 6470-87-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0503-5G |
| cas | 6470-87-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 414.87 Pln | |
| TCI | 25g | 1093.45 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
9,10-dioxoanthracene-2-carbonyl chloride (CAS 6470-87-7) is a chemical compound with the molecular formula C15H7ClO3 and a molecular weight of 270.66 g/mol. IUPAC name: 9,10-dioxoanthracene-2-carbonyl chloride. InChIKey: DGJNWQJOASAMHY-UHFFFAOYSA-N.
| Molecular formula | C15H7ClO3 |
|---|---|
| Molecular weight | 270.66 g/mol |
| IUPAC name | 9,10-dioxoanthracene-2-carbonyl chloride |
| InChIKey | DGJNWQJOASAMHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)C(=O)Cl |
Computed by PubChem (NCBI)