CAS 6470-87-7 appears in our catalog under these names: Anthraquinone-2-carbonyl chloride, 95%, Anthraquinone–2–carbonyl Chloride, Anthraquinone-2-carbonyl Chloride, >98.0%(HPLC)(T), 9,10-Dioxo-9,10-dihydroanthracene-2-carbonyl chloride 98%, 9,10-Dioxo-9,10-Dihydroanthracene-2-Carbonyl Chloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 250mg, 10g.
9,10-dioxoanthracene-2-carbonyl chloride (CAS 6470-87-7) is a chemical compound with the molecular formula C15H7ClO3 and a molecular weight of 270.66 g/mol. IUPAC name: 9,10-dioxoanthracene-2-carbonyl chloride. InChIKey: DGJNWQJOASAMHY-UHFFFAOYSA-N.
| Molecular formula | C15H7ClO3 |
|---|---|
| Molecular weight | 270.66 g/mol |
| IUPAC name | 9,10-dioxoanthracene-2-carbonyl chloride |
| InChIKey | DGJNWQJOASAMHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)C(=O)Cl |
Computed by PubChem (NCBI)