cas: 65795-51-9 — see every product listed under this CAS number, including other names
Antibacterial agent 27 (CAS 65795-51-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC63960-1 |
| cas | 65795-51-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 718.73 Pln | |
| GLPBio | 10mg | 1636.11 Pln | |
| GLPBio | 25mg | 2689.22 Pln | |
| GLPBio | 5mg | 1172.74 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1247.63 Pln | |
| Chemat | 1mg | 299.60 Pln | |
| Chemat | 5mg | 669.20 Pln | |
| Chemat | 10mg | 1029.20 Pln | |
| Chemat | 25mg | 1898.00 Pln | |
| Chemat | 50mg | 2642.00 Pln | |
| Chemat | 100mg | 3544.40 Pln | |
| Chemat | 200mg | 4758.80 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzonitrile (CAS 65795-51-9) is a chemical compound with the molecular formula C18H14N6 and a molecular weight of 314.3 g/mol. IUPAC name: 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzonitrile. InChIKey: IZYHVTAYLHFZSP-UHFFFAOYSA-N.
| Molecular formula | C18H14N6 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzonitrile |
| InChIKey | IZYHVTAYLHFZSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=CC3=C2C=CC4=C3C(=NC(=N4)N)N)C#N |
Computed by PubChem (NCBI)