CAS 52197-22-5 is the registry number for 2,3-Diphenyl-5,8-diaminopyrazino(2,3-d)pyridazine. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
2,3-diphenylpyrazino[2,3-d]pyridazine-5,8-diamine (CAS 52197-22-5) is a chemical compound with the molecular formula C18H14N6 and a molecular weight of 314.3 g/mol. IUPAC name: 2,3-diphenylpyrazino[2,3-d]pyridazine-5,8-diamine. InChIKey: GSOBPIULDMMNIA-UHFFFAOYSA-N.
| Molecular formula | C18H14N6 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 2,3-diphenylpyrazino[2,3-d]pyridazine-5,8-diamine |
| InChIKey | GSOBPIULDMMNIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C(=NN=C3N)N)N=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)