CAS 84176-65-8 appears in our catalog under these names: Antimalarial agent 1/ 97.44% (existing batch purity), Antimalarial agent 1, 2,4-Diamino-6,7-diisopropylpteridine phosphate salt, Antimalarial agent 1 98%, 2,4-DIAMINO-6,7-DIISOPROPYLPTERIDINE*PHO. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 2g, 5g.
6,7-di(propan-2-yl)pteridine-2,4-diamine;phosphoric acid (CAS 84176-65-8) is a chemical compound with the molecular formula C12H21N6O4P and a molecular weight of 344.31 g/mol. IUPAC name: 6,7-di(propan-2-yl)pteridine-2,4-diamine;phosphoric acid. InChIKey: YNQBQYASRYRNRY-UHFFFAOYSA-N.
| Molecular formula | C12H21N6O4P |
|---|---|
| Molecular weight | 344.31 g/mol |
| IUPAC name | 6,7-di(propan-2-yl)pteridine-2,4-diamine;phosphoric acid |
| InChIKey | YNQBQYASRYRNRY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(N=C(N=C2N=C1C(C)C)N)N.OP(=O)(O)O |
Computed by PubChem (NCBI)