CAS 724746-07-0 appears in our catalog under these names: Antimicrobial agent-21/ 99.72% (existing batch purity), Antimicrobial agent–21, 6-Methyl-5-phenyl-2-(pyridin-2-yl)thieno[2,3-d]pyrimidin-4(3H)-one, 98%, 98%, Antimicrobial agent-21, 98.35%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
6-methyl-5-phenyl-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 724746-07-0) is a chemical compound with the molecular formula C18H13N3OS and a molecular weight of 319.4 g/mol. IUPAC name: 6-methyl-5-phenyl-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: BBQMALWNAZQCGJ-UHFFFAOYSA-N.
| Molecular formula | C18H13N3OS |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 6-methyl-5-phenyl-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | BBQMALWNAZQCGJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)N=C(NC2=O)C3=CC=CC=N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)