Products 475626-30-3
CAS 475626-30-3 appears in our catalog under these names: Antitrypanosomal agent 2, Antitrypanosomal agent 2/ 100%, Antitrypanosomal agent 2. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 200mg, 1 mg.
3-[3-phenyl-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrazol-1-yl]propanenitrile (CAS 475626-30-3) is a chemical compound with the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. IUPAC name: 3-[3-phenyl-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrazol-1-yl]propanenitrile. InChIKey: PQFSMDQCXMNEHD-UHFFFAOYSA-N.
| Molecular formula | C17H13N5O3 |
|---|---|
| Molecular weight | 335.32 g/mol |
| IUPAC name | 3-[3-phenyl-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrazol-1-yl]propanenitrile |
| InChIKey | PQFSMDQCXMNEHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2C=C3C(=O)NC(=O)NC3=O)CCC#N |
Computed by PubChem (NCBI)
Synonyms:
Antitrypanosomal agent 2, orb1710411