Antiviral agent 38
cas: 2247932-38-1 — see every product listed under this CAS number, including other names
Antiviral agent 38 (CAS 2247932-38-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress.
| brand | GLPBio |
|---|---|
| catalog number | GC71087-1 |
| cas | 2247932-38-1 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 1345.92 Pln | |
| TargetMol | 1mg | 1428.68 Pln | |
| TargetMol | 5mg | 3022.39 Pln | |
| TargetMol | 10mg | 4350.58 Pln | |
| TargetMol | 25mg | 6422.79 Pln | |
| TargetMol | 50mg | 8906.43 Pln | |
| TargetMol | 100mg | 12120.68 Pln | |
| TargetMol | 500mg | 24047.50 Pln | |
| Chemat | 1mg | 424.40 Pln | |
| Chemat | 5mg | 914.00 Pln | |
| Chemat | 10mg | 1312.40 Pln | |
| Chemat | 25mg | 2042.00 Pln | |
| Chemat | 50mg | 2790.80 Pln | |
| MedChemExpress | 1 mg | 1629.30 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(8R)-8-tert-butyl-13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid (CAS 2247932-38-1) is a chemical compound with the molecular formula C23H27N3O5 and a molecular weight of 425.5 g/mol. IUPAC name: (8R)-8-tert-butyl-13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid. InChIKey: RAHUCUNWBZUOGQ-IBGZPJMESA-N.
| Molecular formula | C23H27N3O5 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (8R)-8-tert-butyl-13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid |
| InChIKey | RAHUCUNWBZUOGQ-IBGZPJMESA-N |
| SMILES | CC(C)(C)[C@@H]1CN2C(=C3C=CC=C(C3=N2)OCCCOC)C4=CC(=O)C(=CN14)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Antiviral agent 38, orb1819233