CAS 72122-59-9 appears in our catalog under these names: b–Casomorphin (1–3), Beta-Casomorphin (1-3). Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 100mg, 50mg, 250mg.
2-[[1-[2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid (CAS 72122-59-9) is a chemical compound with the molecular formula C23H27N3O5 and a molecular weight of 425.5 g/mol. IUPAC name: 2-[[1-[2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid. InChIKey: RCMWNNJFKNDKQR-UHFFFAOYSA-N.
| Molecular formula | C23H27N3O5 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 2-[[1-[2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
| InChIKey | RCMWNNJFKNDKQR-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C(CC2=CC=C(C=C2)O)N)C(=O)NC(CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)