cas: 1267610-26-3 — see every product listed under this CAS number, including other names
Apixaban impurity 11, 99.95% (CAS 1267610-26-3) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 500 mg, 5 g, 1 g, 100 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-I0165-25 g |
| cas | 1267610-26-3 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 733.01 Pln | |
| MedChemExpress | 500 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 370.78 Pln | |
| MedChemExpress | 1 g | 296.47 Pln | |
| MedChemExpress | 100 g | 2256.24 Pln | |
| MedChemExpress | 10 g | 496.16 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.95% |
1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one (CAS 1267610-26-3) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 273.33 g/mol. IUPAC name: 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one. InChIKey: YUGIGSPFTMLIMA-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one |
| InChIKey | YUGIGSPFTMLIMA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C(=C1)N2CCOCC2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)