CAS 2437650-75-2 is the registry number for Apixaban Impurity 159. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one (CAS 2437650-75-2) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 273.33 g/mol. IUPAC name: 1-(3-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one. InChIKey: FIFJIPILWLYJNX-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-(3-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one |
| InChIKey | FIFJIPILWLYJNX-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C(=C1)N2CCOCC2)C3=CC=CC(=C3)N |
Computed by PubChem (NCBI)