CAS 68483-33-0 appears in our catalog under these names: Apyramide/ 98.99% (existing batch purity), Apyramide, 4-acetamidophenyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate, Apyramide, 99.06%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 20mg.
(4-acetamidophenyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 68483-33-0) is a chemical compound with the molecular formula C27H23ClN2O5 and a molecular weight of 490.9 g/mol. IUPAC name: (4-acetamidophenyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: KWUFTKVMXUYTBF-UHFFFAOYSA-N.
| Molecular formula | C27H23ClN2O5 |
|---|---|
| Molecular weight | 490.9 g/mol |
| IUPAC name | (4-acetamidophenyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | KWUFTKVMXUYTBF-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OC4=CC=C(C=C4)NC(=O)C |
Computed by PubChem (NCBI)