CAS 14923-17-2 appears in our catalog under these names: Arcaine sulfate, 95%, Arcaine Sulfate, Arcaine sulfate, Arcaine sulfate/ 99.77% (existing batch purity), ARCAINE SULFATE CRYSTALLINE. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 1g, 250mg, 20mg, 40mg, 10mg, 100mg, 25mg, 5mg.
1-[4-(diaminomethylideneamino)butyl]guanidine;sulfuric acid (CAS 14923-17-2) is a chemical compound with the molecular formula C6H18N6O4S and a molecular weight of 270.31 g/mol. IUPAC name: 1-[4-(diaminomethylideneamino)butyl]guanidine;sulfuric acid. InChIKey: RWTGFMPOODRXIM-UHFFFAOYSA-N.
| Molecular formula | C6H18N6O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 1-[4-(diaminomethylideneamino)butyl]guanidine;sulfuric acid |
| InChIKey | RWTGFMPOODRXIM-UHFFFAOYSA-N |
| SMILES | C(CCN=C(N)N)CNC(=N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)