Products 664992-72-7
CAS 664992-72-7 is the registry number for 5-Bromo-N-(tert-pentyl)furan-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(2-methylbutan-2-yl)furan-2-carboxamide (CAS 664992-72-7) is a chemical compound with the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. IUPAC name: 5-bromo-N-(2-methylbutan-2-yl)furan-2-carboxamide. InChIKey: UWWFAFKECXRNIY-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2 |
|---|---|
| Molecular weight | 260.13 g/mol |
| IUPAC name | 5-bromo-N-(2-methylbutan-2-yl)furan-2-carboxamide |
| InChIKey | UWWFAFKECXRNIY-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NC(=O)C1=CC=C(O1)Br |
Computed by PubChem (NCBI)