CAS 24136-23-0 appears in our catalog under these names: Arhalofenate/ 99.62% (existing batch purity), Arhalofenate (MBX 102), Arhalofenate, Arhalofenate, 99.85%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
2-acetamidoethyl (2R)-2-(4-chlorophenyl)-2-[3-(trifluoromethyl)phenoxy]acetate (CAS 24136-23-0) is a chemical compound with the molecular formula C19H17ClF3NO4 and a molecular weight of 415.8 g/mol. IUPAC name: 2-acetamidoethyl (2R)-2-(4-chlorophenyl)-2-[3-(trifluoromethyl)phenoxy]acetate. InChIKey: BJBCSGQLZQGGIQ-QGZVFWFLSA-N.
| Molecular formula | C19H17ClF3NO4 |
|---|---|
| Molecular weight | 415.8 g/mol |
| IUPAC name | 2-acetamidoethyl (2R)-2-(4-chlorophenyl)-2-[3-(trifluoromethyl)phenoxy]acetate |
| InChIKey | BJBCSGQLZQGGIQ-QGZVFWFLSA-N |
| SMILES | CC(=O)NCCOC(=O)[C@@H](C1=CC=C(C=C1)Cl)OC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)