CAS 120165-51-7 appears in our catalog under these names: Asthma relating compound 1/ 99.51% (existing batch purity), Asthma relating compound 1, 4-(((6-Hydroxy-4,5,7-trimethylbenzo[d]thiazol-2-yl)amino)methyl)benzenesulfonamide, Asthma relating compound 1. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 1mg, 10mg, 20mg, 5mg, 10 mg.
4-[[(6-hydroxy-4,5,7-trimethyl-1,3-benzothiazol-2-yl)amino]methyl]benzenesulfonamide (CAS 120165-51-7) is a chemical compound with the molecular formula C17H19N3O3S2 and a molecular weight of 377.5 g/mol. IUPAC name: 4-[[(6-hydroxy-4,5,7-trimethyl-1,3-benzothiazol-2-yl)amino]methyl]benzenesulfonamide. InChIKey: IKIAJUVGDUYASS-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O3S2 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 4-[[(6-hydroxy-4,5,7-trimethyl-1,3-benzothiazol-2-yl)amino]methyl]benzenesulfonamide |
| InChIKey | IKIAJUVGDUYASS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1N=C(S2)NCC3=CC=C(C=C3)S(=O)(=O)N)C)O)C |
Computed by PubChem (NCBI)