CAS 946293-78-3 appears in our catalog under these names: Aumitin, Aumitin/ 99.13% (existing batch purity), Aumitin 99%, Aumitin, 99.78%, 2-Chloro-N-(4-((4-methyl-6-(phenylamino)pyrimidin-2-yl)amino)phenyl)benzamide, 99%, 99%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 200mg.
N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-chlorobenzamide (CAS 946293-78-3) is a chemical compound with the molecular formula C24H20ClN5O and a molecular weight of 429.9 g/mol. IUPAC name: N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-chlorobenzamide. InChIKey: VJNNQBDSUIVCKB-UHFFFAOYSA-N.
| Molecular formula | C24H20ClN5O |
|---|---|
| Molecular weight | 429.9 g/mol |
| IUPAC name | N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-chlorobenzamide |
| InChIKey | VJNNQBDSUIVCKB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC2=CC=C(C=C2)NC(=O)C3=CC=CC=C3Cl)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)