CAS 918407-35-9 appears in our catalog under these names: Avoralstat/ 95.12% (existing batch purity), Avoralstat (BCX4161), Avoralstat, Avoralstat 96%, Avoralstat, 98.0%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 2mg.
3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylic acid (CAS 918407-35-9) is a chemical compound with the molecular formula C28H27N5O5 and a molecular weight of 513.5 g/mol. IUPAC name: 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylic acid. InChIKey: TUWMKPVJGGWGNL-UHFFFAOYSA-N.
| Molecular formula | C28H27N5O5 |
|---|---|
| Molecular weight | 513.5 g/mol |
| IUPAC name | 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylic acid |
| InChIKey | TUWMKPVJGGWGNL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C=C)C(=O)NC2=CC=C(C=C2)C(=N)N)C3=C(N=C(C=C3)C(=O)NCC4CC4)C(=O)O |
Computed by PubChem (NCBI)