CAS 1983983-41-0 appears in our catalog under these names: Avotaciclib/ 97.98% (existing batch purity), Avotaciclib, Avotaciclib 98%, Avotaciclib, 99.72%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
2,6-bis(2-aminopyrimidin-4-yl)pyridin-3-ol (CAS 1983983-41-0) is a chemical compound with the molecular formula C13H11N7O and a molecular weight of 281.27 g/mol. IUPAC name: 2,6-bis(2-aminopyrimidin-4-yl)pyridin-3-ol. InChIKey: VFVAQKKPFOPZEA-UHFFFAOYSA-N.
| Molecular formula | C13H11N7O |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 2,6-bis(2-aminopyrimidin-4-yl)pyridin-3-ol |
| InChIKey | VFVAQKKPFOPZEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1O)C2=NC(=NC=C2)N)C3=NC(=NC=C3)N |
Computed by PubChem (NCBI)