CAS 877239-09-3 appears in our catalog under these names: Azido-PEG10-alcohol/ min. 98%, Azido–PEG10–alcohol, Azido-PEG10-alcohol 95%, 29-Azido-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol, 95%, 95%, Azido-PEG10-alcohol, 97.0%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g, 100 mg, 1 g, 250 mg.
2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 877239-09-3) is a chemical compound with the molecular formula C20H41N3O10 and a molecular weight of 483.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: SPGCITRFWPBATM-UHFFFAOYSA-N.
| Molecular formula | C20H41N3O10 |
|---|---|
| Molecular weight | 483.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | SPGCITRFWPBATM-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCO)N=[N+]=[N-] |
Computed by PubChem (NCBI)