CAS 1984776-37-5 appears in our catalog under these names: Azido-PEG9-alcohol/ 98%, Azido–PEG9–alcohol, Azido-PEG9-alcohol 95%, Azido-PEG9-alcohol, 99.95%, Azido-PEG9-alcohol, 98%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 50 mg, 250 mg, 100 mg, 1 g.
2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 1984776-37-5) is a chemical compound with the molecular formula C18H37N3O9 and a molecular weight of 439.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: XMVVXXBINVVEME-UHFFFAOYSA-N.
| Molecular formula | C18H37N3O9 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | XMVVXXBINVVEME-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCO)N=[N+]=[N-] |
Computed by PubChem (NCBI)